C29H42O5Si2 — CID 15896566
5-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenylchromen-4-one (PubChem CID 15896566) has the molecular formula C29H42O5Si2 and a molecular weight of 526.82 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenylchromen-4-one.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 15896566 |
| Molecular Formula | C29H42O5Si2 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-7-[2-[tert-butyl(dimethyl)silyl]oxyethoxy]-2-phenylchromen-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCOc1cc(O[Si](C)(C)C(C)(C)C)c2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C29H42O5Si2/c1-28(2,3)35(7,8)32-17-16-31-22-18-25-27(26(19-22)34-36(9,10)29(4,5)6)23(30)20-24(33-25)21-14-12-11-13-15-21/h11-15,18-20H,16-17H2,1-10H3 |
| InChIKey | DTLWQYCBNBEFIJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|