C60H56N6O9 — CID 158989628
N-benzyl-1H-indole-2-carboxamide;N-benzyl-1-methylindole-2-carboxamide;[5-[(1H-indole-2-carbonylamino)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate (PubChem CID 158989628) has the molecular formula C60H56N6O9 and a molecular weight of 1005.14 g/mol. Its IUPAC name is N-benzyl-1H-indole-2-carboxamide;N-benzyl-1-methylindole-2-carboxamide;[5-[(1H-indole-2-carbonylamino)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate.
| Compound Name | N-benzyl-1H-indole-2-carboxamide;N-benzyl-1-methylindole-2-carboxamide;[5-[(1H-indole-2-carbonylamino)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 158989628 |
| Molecular Formula | C60H56N6O9 |
| Molecular Weight | 1005.14 g/mol |
| Exact Mass | 1004.41 |
| IUPAC Name | N-benzyl-1H-indole-2-carboxamide;N-benzyl-1-methylindole-2-carboxamide;[5-[(1H-indole-2-carbonylamino)methyl]-2-methoxyphenyl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1ccc(CNC(=O)c2cc3ccccc3[nH]2)cc1OC(=O)c1cc(OC)c(OC)c(OC)c1.Cn1c(C(=O)NCc2ccccc2)cc2ccccc21.O=C(NCc1ccccc1)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C27H26N2O7.C17H16N2O.C16H14N2O/c1-32-21-10-9-16(15-28-26(30)20-12-17-7-5-6-8-19(17)29-20)11-22(21)36-27(31)18-13-23(33-2)25(35-4)24(14-18)34-3;1-19-15-10-6-5-9-14(15)11-16(19)17(20)18-12-13-7-3-2-4-8-13;19-16(17-11-12-6-2-1-3-7-12)15-10-13-8-4-5-9-14(13)18-15/h5-14,29H,15H2,1-4H3,(H,28,30);2-11H,12H2,1H3,(H,18,20);1-10,18H,11H2,(H,17,19) |
| InChIKey | JPZPULMNGZWYIE-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 187.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.14 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|