C13H10ClFO10S4 — CID 159013050
4-[(2-chloro-4-fluorophenyl)sulfonylmethylsulfonyl]benzene-1,3-disulfonic acid (PubChem CID 159013050) has the molecular formula C13H10ClFO10S4 and a molecular weight of 508.93 g/mol. Its IUPAC name is 4-[(2-chloro-4-fluorophenyl)sulfonylmethylsulfonyl]benzene-1,3-disulfonic acid.
| Compound Name | 4-[(2-chloro-4-fluorophenyl)sulfonylmethylsulfonyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 159013050 |
| Molecular Formula | C13H10ClFO10S4 |
| Molecular Weight | 508.93 g/mol |
| Exact Mass | 507.88 |
| IUPAC Name | 4-[(2-chloro-4-fluorophenyl)sulfonylmethylsulfonyl]benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(S(=O)(=O)CS(=O)(=O)c2ccc(F)cc2Cl)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C13H10ClFO10S4/c14-10-5-8(15)1-3-11(10)26(16,17)7-27(18,19)12-4-2-9(28(20,21)22)6-13(12)29(23,24)25/h1-6H,7H2,(H,20,21,22)(H,23,24,25) |
| InChIKey | MQKNLNVWRJBDLR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.93 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|