C11H13N5O2 — CID 159065836
N-(diaminomethylidene)-2-(dimethylamino)-6-hydroxy-3-isocyanobenzamide (PubChem CID 159065836) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-(dimethylamino)-6-hydroxy-3-isocyanobenzamide.
| Compound Name | N-(diaminomethylidene)-2-(dimethylamino)-6-hydroxy-3-isocyanobenzamide |
|---|---|
| PubChem CID | 159065836 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-(diaminomethylidene)-2-(dimethylamino)-6-hydroxy-3-isocyanobenzamide |
| SMILES | [C-]#[N+]c1ccc(O)c(C(=O)N=C(N)N)c1N(C)C |
| InChI | InChI=1S/C11H13N5O2/c1-14-6-4-5-7(17)8(9(6)16(2)3)10(18)15-11(12)13/h4-5,17H,2-3H3,(H4,12,13,15,18) |
| InChIKey | JZASNTPXRWSWLR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|