C40H49F3N4O — CID 15907641
(E)-1,1,1-trifluoro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)but-3-en-2-ol (PubChem CID 15907641) has the molecular formula C40H49F3N4O and a molecular weight of 658.85 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)but-3-en-2-ol.
| Compound Name | (E)-1,1,1-trifluoro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 15907641 |
| Molecular Formula | C40H49F3N4O |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.39 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(2,3,7,8,12,13,17,18-octaethyl-23,24-dihydroporphyrin-5-yl)but-3-en-2-ol |
| SMILES | CCC1=C(CC)c2nc1cc1[nH]c(cc3[nH]c(cc4nc(c2/C=C/C(O)C(F)(F)F)C(CC)=C4CC)c(CC)c3CC)c(CC)c1CC |
| InChI | InChI=1S/C40H49F3N4O/c1-9-22-24(11-3)33-20-35-26(13-5)28(15-7)38(46-35)30(17-18-37(48)40(41,42)43)39-29(16-8)27(14-6)36(47-39)21-34-25(12-4)23(10-2)32(45-34)19-31(22)44-33/h17-21,37,44-45,48H,9-16H2,1-8H3/b18-17+,31-19-,32-19-,33-20-,34-21-,35-20-,36-21-,38-30-,39-30- |
| InChIKey | VNXVEVNWWRPAEP-LNMJKTORSA-N |
| XLogP | 10.96 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |