C33H42N2 — CID 15909342
N-[(Z)-3-[2,6-di(propan-2-yl)phenyl]imino-2-phenylprop-1-enyl]-2,6-di(propan-2-yl)aniline (PubChem CID 15909342) has the molecular formula C33H42N2 and a molecular weight of 466.71 g/mol. Its IUPAC name is N-[(Z)-3-[2,6-di(propan-2-yl)phenyl]imino-2-phenylprop-1-enyl]-2,6-di(propan-2-yl)aniline.
| Compound Name | N-[(Z)-3-[2,6-di(propan-2-yl)phenyl]imino-2-phenylprop-1-enyl]-2,6-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 15909342 |
| Molecular Formula | C33H42N2 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | N-[(Z)-3-[2,6-di(propan-2-yl)phenyl]imino-2-phenylprop-1-enyl]-2,6-di(propan-2-yl)aniline |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/C(=C\Nc1c(C(C)C)cccc1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H42N2/c1-22(2)28-16-12-17-29(23(3)4)32(28)34-20-27(26-14-10-9-11-15-26)21-35-33-30(24(5)6)18-13-19-31(33)25(7)8/h9-25,34H,1-8H3/b27-20+,35-21+ |
| InChIKey | CXZKRSHNHHNFCO-MMSCVZKOSA-N |
| XLogP | 10.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|