C9H16INO3 — CID 159105630
3-(5-iodo-4-oxopentoxy)-N-methylpropanamide (PubChem CID 159105630) has the molecular formula C9H16INO3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 3-(5-iodo-4-oxopentoxy)-N-methylpropanamide.
| Compound Name | 3-(5-iodo-4-oxopentoxy)-N-methylpropanamide |
|---|---|
| PubChem CID | 159105630 |
| Molecular Formula | C9H16INO3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-(5-iodo-4-oxopentoxy)-N-methylpropanamide |
| SMILES | CNC(=O)CCOCCCC(=O)CI |
| InChI | InChI=1S/C9H16INO3/c1-11-9(13)4-6-14-5-2-3-8(12)7-10/h2-7H2,1H3,(H,11,13) |
| InChIKey | KDVOGQTXUCFIIN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|