About 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid
3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid (PubChem CID 159114114) has the molecular formula C26H20Br2O9
and a molecular weight of 636.25 g/mol. Its IUPAC name is 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid.
Molecular Properties
| Compound Name | 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid |
| PubChem CID | 159114114 |
| Molecular Formula | C26H20Br2O9 |
| Molecular Weight | 636.25 g/mol |
| Exact Mass | 633.95 |
| IUPAC Name | 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid |
| SMILES | O=C(O)C(=O)Cc1ccc(Br)cc1.O=C(O)C(=O)Cc1ccccc1Br.O=C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/2C9H7BrO3.C8H6O3/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;10-7-4-2-1-3-6(7)5-8(11)9(12)13;9-7(8(10)11)6-4-2-1-3-5-6/h2*1-4H,5H2,(H,12,13);1-5H,(H,10,11) |
| InChIKey | KEWDMSKYLZAQLR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 636.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid?
The IUPAC name of 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid (CID 159114114) is 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid.
What is the SMILES notation for 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid?
The canonical SMILES for 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid is O=C(O)C(=O)Cc1ccc(Br)cc1.O=C(O)C(=O)Cc1ccccc1Br.O=C(O)C(=O)c1ccccc1.
What is the InChIKey of 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid?
The InChIKey is KEWDMSKYLZAQLR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7BrO3.C8H6O3/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;10-7-4-2-1-3-6(7)5-8(11)9(12)13;9-7(8(10)11)6-4-2-1-3-5-6/h2*1-4H,5H2,(H,12,13);1-5H,(H,10,11).
What are the key properties of 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid?
3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid has a molecular weight of 636.25 g/mol, XLogP of 4.24, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bromophenyl)-2-oxopropanoic acid;3-(4-bromophenyl)-2-oxopropanoic acid;2-oxo-2-phenylacetic acid is sourced from PubChem (CID 159114114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).