C14H21NO4S — CID 159137887
[4-(methylsulfonylmethyl)phenyl]methyl (2S)-2-amino-3-methylbutanoate (PubChem CID 159137887) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is [4-(methylsulfonylmethyl)phenyl]methyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | [4-(methylsulfonylmethyl)phenyl]methyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 159137887 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | [4-(methylsulfonylmethyl)phenyl]methyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OCc1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-10(2)13(15)14(16)19-8-11-4-6-12(7-5-11)9-20(3,17)18/h4-7,10,13H,8-9,15H2,1-3H3/t13-/m0/s1 |
| InChIKey | CHKLKDHIDCMVNG-ZDUSSCGKSA-N |
| XLogP | 1.26 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |