C11H19Cl3 — CID 159161926
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;chloroform (PubChem CID 159161926) has the molecular formula C11H19Cl3 and a molecular weight of 257.63 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;chloroform.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;chloroform |
|---|---|
| PubChem CID | 159161926 |
| Molecular Formula | C11H19Cl3 |
| Molecular Weight | 257.63 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene;chloroform |
| SMILES | C1CCC2CCCCC2C1.ClC(Cl)Cl |
| InChI | InChI=1S/C10H18.CHCl3/c1-2-6-10-8-4-3-7-9(10)5-1;2-1(3)4/h9-10H,1-8H2;1H |
| InChIKey | KKPBAIACARPFOQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.63 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|