C32H35NO4 — CID 159174762
9H-fluoren-9-ylmethyl 4-[2-oxopentyl(3-phenylpropanoyl)amino]butanoate (PubChem CID 159174762) has the molecular formula C32H35NO4 and a molecular weight of 497.64 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 4-[2-oxopentyl(3-phenylpropanoyl)amino]butanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 4-[2-oxopentyl(3-phenylpropanoyl)amino]butanoate |
|---|---|
| PubChem CID | 159174762 |
| Molecular Formula | C32H35NO4 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 4-[2-oxopentyl(3-phenylpropanoyl)amino]butanoate |
| SMILES | CCCC(=O)CN(CCCC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C32H35NO4/c1-2-11-25(34)22-33(31(35)20-19-24-12-4-3-5-13-24)21-10-18-32(36)37-23-30-28-16-8-6-14-26(28)27-15-7-9-17-29(27)30/h3-9,12-17,30H,2,10-11,18-23H2,1H3 |
| InChIKey | LISZBWVKZATCMS-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |