C24H33FINO3 — CID 159187900
butyl 3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)-8λ3-iodabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 159187900) has the molecular formula C24H33FINO3 and a molecular weight of 529.43 g/mol. Its IUPAC name is butyl 3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)-8λ3-iodabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | butyl 3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)-8λ3-iodabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 159187900 |
| Molecular Formula | C24H33FINO3 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | butyl 3-(5-fluorospiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)-8λ3-iodabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CCCCOC(=O)I1C2CCC1CC(N1CCC3(CC1)COc1ccc(F)cc13)C2 |
| InChI | InChI=1S/C24H33FINO3/c1-2-3-12-29-23(28)26-18-5-6-19(26)15-20(14-18)27-10-8-24(9-11-27)16-30-22-7-4-17(25)13-21(22)24/h4,7,13,18-20H,2-3,5-6,8-12,14-16H2,1H3 |
| InChIKey | KNSKHKAXLQIKRX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|