C58H49BBr2N4O5 — CID 159192477
7,10-bis(4-ethoxyphenyl)-3-methylphenanthro[9,10-b]pyrazine;7,10-dibromo-3-methylphenanthro[9,10-b]pyrazine;(4-ethoxyphenyl)boronic acid (PubChem CID 159192477) has the molecular formula C58H49BBr2N4O5 and a molecular weight of 1052.67 g/mol. Its IUPAC name is 7,10-bis(4-ethoxyphenyl)-3-methylphenanthro[9,10-b]pyrazine;7,10-dibromo-3-methylphenanthro[9,10-b]pyrazine;(4-ethoxyphenyl)boronic acid.
| Compound Name | 7,10-bis(4-ethoxyphenyl)-3-methylphenanthro[9,10-b]pyrazine;7,10-dibromo-3-methylphenanthro[9,10-b]pyrazine;(4-ethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 159192477 |
| Molecular Formula | C58H49BBr2N4O5 |
| Molecular Weight | 1052.67 g/mol |
| Exact Mass | 1050.22 |
| IUPAC Name | 7,10-bis(4-ethoxyphenyl)-3-methylphenanthro[9,10-b]pyrazine;7,10-dibromo-3-methylphenanthro[9,10-b]pyrazine;(4-ethoxyphenyl)boronic acid |
| SMILES | CCOc1ccc(-c2ccc3c(c2)c2cc(-c4ccc(OCC)cc4)ccc2c2nc(C)cnc32)cc1.CCOc1ccc(B(O)O)cc1.Cc1cnc2c3ccc(Br)cc3c3cc(Br)ccc3c2n1 |
| InChI | InChI=1S/C33H28N2O2.C17H10Br2N2.C8H11BO3/c1-4-36-26-12-6-22(7-13-26)24-10-16-28-30(18-24)31-19-25(23-8-14-27(15-9-23)37-5-2)11-17-29(31)33-32(28)34-20-21(3)35-33;1-9-8-20-16-12-4-2-10(18)6-14(12)15-7-11(19)3-5-13(15)17(16)21-9;1-2-12-8-5-3-7(4-6-8)9(10)11/h6-20H,4-5H2,1-3H3;2-8H,1H3;3-6,10-11H,2H2,1H3 |
| InChIKey | KOGKTNJSUVPSET-UHFFFAOYSA-N |
| XLogP | 13.91 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1052.67 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|