C24H30ClFN4O2 — CID 159202938
1-[4-[4-(2-chloro-4-fluoro-5-methylphenyl)piperazin-1-yl]butoxy]-4,5-dihydro-3H-1,3-benzodiazepin-2-one (PubChem CID 159202938) has the molecular formula C24H30ClFN4O2 and a molecular weight of 460.98 g/mol. Its IUPAC name is 1-[4-[4-(2-chloro-4-fluoro-5-methylphenyl)piperazin-1-yl]butoxy]-4,5-dihydro-3H-1,3-benzodiazepin-2-one.
| Compound Name | 1-[4-[4-(2-chloro-4-fluoro-5-methylphenyl)piperazin-1-yl]butoxy]-4,5-dihydro-3H-1,3-benzodiazepin-2-one |
|---|---|
| PubChem CID | 159202938 |
| Molecular Formula | C24H30ClFN4O2 |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 1-[4-[4-(2-chloro-4-fluoro-5-methylphenyl)piperazin-1-yl]butoxy]-4,5-dihydro-3H-1,3-benzodiazepin-2-one |
| SMILES | Cc1cc(N2CCN(CCCCON3C(=O)NCCc4ccccc43)CC2)c(Cl)cc1F |
| InChI | InChI=1S/C24H30ClFN4O2/c1-18-16-23(20(25)17-21(18)26)29-13-11-28(12-14-29)10-4-5-15-32-30-22-7-3-2-6-19(22)8-9-27-24(30)31/h2-3,6-7,16-17H,4-5,8-15H2,1H3,(H,27,31) |
| InChIKey | KPNCOZNCZHUGNU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|