C38H46NaO6P — CID 159223986
sodium bis[4-[5-(4-hydroxyphenyl)heptan-3-yl]phenyl] phosphate (PubChem CID 159223986) has the molecular formula C38H46NaO6P and a molecular weight of 652.74 g/mol. Its IUPAC name is sodium bis[4-[5-(4-hydroxyphenyl)heptan-3-yl]phenyl] phosphate.
| Compound Name | sodium bis[4-[5-(4-hydroxyphenyl)heptan-3-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 159223986 |
| Molecular Formula | C38H46NaO6P |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | sodium bis[4-[5-(4-hydroxyphenyl)heptan-3-yl]phenyl] phosphate |
| SMILES | CCC(CC(CC)c1ccc(OP(=O)([O-])Oc2ccc(C(CC)CC(CC)c3ccc(O)cc3)cc2)cc1)c1ccc(O)cc1.[Na+] |
| InChI | InChI=1S/C38H47O6P.Na/c1-5-27(31-9-17-35(39)18-10-31)25-29(7-3)33-13-21-37(22-14-33)43-45(41,42)44-38-23-15-34(16-24-38)30(8-4)26-28(6-2)32-11-19-36(40)20-12-32;/h9-24,27-30,39-40H,5-8,25-26H2,1-4H3,(H,41,42);/q;+1/p-1 |
| InChIKey | KSAXXHNWBWHTDC-UHFFFAOYSA-M |
| XLogP | 7.18 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|