C17H24N2O7 — CID 159229319
[4-(3-nitrooxypropyl)phenyl] 7-amino-3-formyloxyheptanoate (PubChem CID 159229319) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is [4-(3-nitrooxypropyl)phenyl] 7-amino-3-formyloxyheptanoate.
| Compound Name | [4-(3-nitrooxypropyl)phenyl] 7-amino-3-formyloxyheptanoate |
|---|---|
| PubChem CID | 159229319 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [4-(3-nitrooxypropyl)phenyl] 7-amino-3-formyloxyheptanoate |
| SMILES | NCCCCC(CC(=O)Oc1ccc(CCCO[N+](=O)[O-])cc1)OC=O |
| InChI | InChI=1S/C17H24N2O7/c18-10-2-1-5-16(24-13-20)12-17(21)26-15-8-6-14(7-9-15)4-3-11-25-19(22)23/h6-9,13,16H,1-5,10-12,18H2 |
| InChIKey | JNDFFCPGTIRZNS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|