C25H32N6O12 — CID 143731183
5-[[amino-[[4-(2-nitrooxyethyl)phenoxy]carbonylamino]methylidene]amino]-2-(methylamino)pentanoic acid;[4-(2-nitrooxyethyl)phenyl] formate (PubChem CID 143731183) has the molecular formula C25H32N6O12 and a molecular weight of 608.56 g/mol. Its IUPAC name is 5-[[amino-[[4-(2-nitrooxyethyl)phenoxy]carbonylamino]methylidene]amino]-2-(methylamino)pentanoic acid;[4-(2-nitrooxyethyl)phenyl] formate.
| Compound Name | 5-[[amino-[[4-(2-nitrooxyethyl)phenoxy]carbonylamino]methylidene]amino]-2-(methylamino)pentanoic acid;[4-(2-nitrooxyethyl)phenyl] formate |
|---|---|
| PubChem CID | 143731183 |
| Molecular Formula | C25H32N6O12 |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 5-[[amino-[[4-(2-nitrooxyethyl)phenoxy]carbonylamino]methylidene]amino]-2-(methylamino)pentanoic acid;[4-(2-nitrooxyethyl)phenyl] formate |
| SMILES | CNC(CCC/N=C(\N)NC(=O)Oc1ccc(CCO[N+](=O)[O-])cc1)C(=O)O.O=COc1ccc(CCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23N5O7.C9H9NO5/c1-18-13(14(22)23)3-2-9-19-15(17)20-16(24)28-12-6-4-11(5-7-12)8-10-27-21(25)26;11-7-14-9-3-1-8(2-4-9)5-6-15-10(12)13/h4-7,13,18H,2-3,8-10H2,1H3,(H,22,23)(H3,17,19,20,24);1-4,7H,5-6H2 |
| InChIKey | KHVWHEWSOBMFPH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 257.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|