C15H25N3O10 — CID 159309782
[10-nitrooxy-1-(4-nitrooxybutanoylamino)-7-oxodecan-5-yl] formate (PubChem CID 159309782) has the molecular formula C15H25N3O10 and a molecular weight of 407.38 g/mol. Its IUPAC name is [10-nitrooxy-1-(4-nitrooxybutanoylamino)-7-oxodecan-5-yl] formate.
| Compound Name | [10-nitrooxy-1-(4-nitrooxybutanoylamino)-7-oxodecan-5-yl] formate |
|---|---|
| PubChem CID | 159309782 |
| Molecular Formula | C15H25N3O10 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [10-nitrooxy-1-(4-nitrooxybutanoylamino)-7-oxodecan-5-yl] formate |
| SMILES | O=COC(CCCCNC(=O)CCCO[N+](=O)[O-])CC(=O)CCCO[N+](=O)[O-] |
| InChI | InChI=1S/C15H25N3O10/c19-12-26-14(11-13(20)5-3-9-27-17(22)23)6-1-2-8-16-15(21)7-4-10-28-18(24)25/h12,14H,1-11H2,(H,16,21) |
| InChIKey | PMDDZUUCGRYDFX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|