About 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride
3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride (PubChem CID 159241538) has the molecular formula C30H65ClN2O3
and a molecular weight of 537.31 g/mol. Its IUPAC name is 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride.
Molecular Properties
| Compound Name | 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride |
| PubChem CID | 159241538 |
| Molecular Formula | C30H65ClN2O3 |
| Molecular Weight | 537.31 g/mol |
| Exact Mass | 536.47 |
| IUPAC Name | 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride |
| SMILES | CCCCCCCCCCCCCCCCCCCCCC(=O)O.C[N+](C)(CCCN)CCCO.[Cl-] |
| InChI | InChI=1S/C22H44O2.C8H21N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-10(2,6-3-5-9)7-4-8-11;/h2-21H2,1H3,(H,23,24);11H,3-9H2,1-2H3;1H/q;+1;/p-1 |
| InChIKey | SAGUSLNWQVALOY-UHFFFAOYSA-M |
| XLogP | 4.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride?
The IUPAC name of 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride (CID 159241538) is 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride.
What is the SMILES notation for 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride?
The canonical SMILES for 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride is CCCCCCCCCCCCCCCCCCCCCC(=O)O.C[N+](C)(CCCN)CCCO.[Cl-].
What is the InChIKey of 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride?
The InChIKey is SAGUSLNWQVALOY-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H44O2.C8H21N2O.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24;1-10(2,6-3-5-9)7-4-8-11;/h2-21H2,1H3,(H,23,24);11H,3-9H2,1-2H3;1H/q;+1;/p-1.
What are the key properties of 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride?
3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride has a molecular weight of 537.31 g/mol, XLogP of 4.69, 26 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl-(3-hydroxypropyl)-dimethylazanium;docosanoic acid;chloride is sourced from PubChem (CID 159241538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).