C20H32NO3+ — CID 159253878
butanoyloxymethyl-[3-(2,6-dimethylphenyl)-2-oxopropyl]-diethylazanium (PubChem CID 159253878) has the molecular formula C20H32NO3+ and a molecular weight of 334.48 g/mol. Its IUPAC name is butanoyloxymethyl-[3-(2,6-dimethylphenyl)-2-oxopropyl]-diethylazanium.
| Compound Name | butanoyloxymethyl-[3-(2,6-dimethylphenyl)-2-oxopropyl]-diethylazanium |
|---|---|
| PubChem CID | 159253878 |
| Molecular Formula | C20H32NO3+ |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | butanoyloxymethyl-[3-(2,6-dimethylphenyl)-2-oxopropyl]-diethylazanium |
| SMILES | CCCC(=O)OC[N+](CC)(CC)CC(=O)Cc1c(C)cccc1C |
| InChI | InChI=1S/C20H32NO3/c1-6-10-20(23)24-15-21(7-2,8-3)14-18(22)13-19-16(4)11-9-12-17(19)5/h9,11-12H,6-8,10,13-15H2,1-5H3/q+1 |
| InChIKey | HPFVJEYYRQGXMD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|