C34H30BBrF2N4O6 — CID 159266760
methyl 2-bromo-5-fluoropyridine-4-carboxylate;methyl 2-(4-cyanophenyl)-5-fluoropyridine-4-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 159266760) has the molecular formula C34H30BBrF2N4O6 and a molecular weight of 719.35 g/mol. Its IUPAC name is methyl 2-bromo-5-fluoropyridine-4-carboxylate;methyl 2-(4-cyanophenyl)-5-fluoropyridine-4-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | methyl 2-bromo-5-fluoropyridine-4-carboxylate;methyl 2-(4-cyanophenyl)-5-fluoropyridine-4-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 159266760 |
| Molecular Formula | C34H30BBrF2N4O6 |
| Molecular Weight | 719.35 g/mol |
| Exact Mass | 718.14 |
| IUPAC Name | methyl 2-bromo-5-fluoropyridine-4-carboxylate;methyl 2-(4-cyanophenyl)-5-fluoropyridine-4-carboxylate;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2ccc(C#N)cc2)OC1(C)C.COC(=O)c1cc(-c2ccc(C#N)cc2)ncc1F.COC(=O)c1cc(Br)ncc1F |
| InChI | InChI=1S/C14H9FN2O2.C13H16BNO2.C7H5BrFNO2/c1-19-14(18)11-6-13(17-8-12(11)15)10-4-2-9(7-16)3-5-10;1-12(2)13(3,4)17-14(16-12)11-7-5-10(9-15)6-8-11;1-12-7(11)4-2-6(8)10-3-5(4)9/h2-6,8H,1H3;5-8H,1-4H3;2-3H,1H3 |
| InChIKey | KXEZKIZJGWYZRK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 144.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.35 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|