C37H57N5O8S2 — CID 159283869
6-[2-[3-[3-[6-[[5-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxopentanoyl]amino]hexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]-4-oxohexanamide (PubChem CID 159283869) has the molecular formula C37H57N5O8S2 and a molecular weight of 764.02 g/mol. Its IUPAC name is 6-[2-[3-[3-[6-[[5-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxopentanoyl]amino]hexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]-4-oxohexanamide.
| Compound Name | 6-[2-[3-[3-[6-[[5-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxopentanoyl]amino]hexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]-4-oxohexanamide |
|---|---|
| PubChem CID | 159283869 |
| Molecular Formula | C37H57N5O8S2 |
| Molecular Weight | 764.02 g/mol |
| Exact Mass | 763.36 |
| IUPAC Name | 6-[2-[3-[3-[6-[[5-[(6S)-6-butyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]-4-oxopentanoyl]amino]hexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]propanoylamino]ethoxy]-4-oxohexanamide |
| SMILES | CCCC[C@H]1CCc2nc(CC(=O)CCC(=O)NCCCCCCSC3CC(=O)N(CCC(=O)NCCOCCC(=O)CCC(N)=O)C3=O)sc2C1 |
| InChI | InChI=1S/C37H57N5O8S2/c1-2-3-8-26-9-12-29-30(23-26)52-35(41-29)24-28(44)11-14-33(46)39-17-6-4-5-7-22-51-31-25-36(48)42(37(31)49)19-15-34(47)40-18-21-50-20-16-27(43)10-13-32(38)45/h26,31H,2-25H2,1H3,(H2,38,45)(H,39,46)(H,40,47)/t26-,31?/m0/s1 |
| InChIKey | WUBVWEKEUQVNBS-PAMMARIWSA-N |
| XLogP | 3.61 |
| TPSA | 194.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.02 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|