C15H18F3O6S2+ — CID 159314363
2,2-difluoro-2-sulfoacetic acid;(4-fluorophenyl)-methyl-(2-oxocyclohexyl)sulfanium (PubChem CID 159314363) has the molecular formula C15H18F3O6S2+ and a molecular weight of 415.43 g/mol. Its IUPAC name is 2,2-difluoro-2-sulfoacetic acid;(4-fluorophenyl)-methyl-(2-oxocyclohexyl)sulfanium.
| Compound Name | 2,2-difluoro-2-sulfoacetic acid;(4-fluorophenyl)-methyl-(2-oxocyclohexyl)sulfanium |
|---|---|
| PubChem CID | 159314363 |
| Molecular Formula | C15H18F3O6S2+ |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | 2,2-difluoro-2-sulfoacetic acid;(4-fluorophenyl)-methyl-(2-oxocyclohexyl)sulfanium |
| SMILES | C[S+](c1ccc(F)cc1)C1CCCCC1=O.O=C(O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C13H16FOS.C2H2F2O5S/c1-16(11-8-6-10(14)7-9-11)13-5-3-2-4-12(13)15;3-2(4,1(5)6)10(7,8)9/h6-9,13H,2-5H2,1H3;(H,5,6)(H,7,8,9)/q+1; |
| InChIKey | LCYGZLSJYVGFOH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|