C43H48N4O4S — CID 159347972
(2R,5S)-2-(4-aminobutyl)-N-benzhydryl-5-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-4-oxo-6-thiophen-2-ylhexanamide (PubChem CID 159347972) has the molecular formula C43H48N4O4S and a molecular weight of 716.95 g/mol. Its IUPAC name is (2R,5S)-2-(4-aminobutyl)-N-benzhydryl-5-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-4-oxo-6-thiophen-2-ylhexanamide.
| Compound Name | (2R,5S)-2-(4-aminobutyl)-N-benzhydryl-5-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-4-oxo-6-thiophen-2-ylhexanamide |
|---|---|
| PubChem CID | 159347972 |
| Molecular Formula | C43H48N4O4S |
| Molecular Weight | 716.95 g/mol |
| Exact Mass | 716.34 |
| IUPAC Name | (2R,5S)-2-(4-aminobutyl)-N-benzhydryl-5-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-4-oxo-6-thiophen-2-ylhexanamide |
| SMILES | CCC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@@H](Cc1cccs1)C(=O)C[C@@H](CCCCN)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H48N4O4S/c1-2-40(49)45-38(27-30-22-23-31-14-9-10-19-34(31)26-30)43(51)46-37(29-36-21-13-25-52-36)39(48)28-35(20-11-12-24-44)42(50)47-41(32-15-5-3-6-16-32)33-17-7-4-8-18-33/h3-10,13-19,21-23,25-26,35,37-38,41H,2,11-12,20,24,27-29,44H2,1H3,(H,45,49)(H,46,51)(H,47,50)/t35-,37+,38+/m1/s1 |
| InChIKey | LGYRKYLWBUSFCZ-JSIAWMENSA-N |
| XLogP | 6.68 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|