C38H51N5O4 — CID 162174004
(2R)-6-amino-N-[(1R)-2-amino-1-phenylethyl]-2-[(3S)-3-cyclopentyl-3-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-2-oxopropyl]hexanamide (PubChem CID 162174004) has the molecular formula C38H51N5O4 and a molecular weight of 641.86 g/mol. Its IUPAC name is (2R)-6-amino-N-[(1R)-2-amino-1-phenylethyl]-2-[(3S)-3-cyclopentyl-3-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-2-oxopropyl]hexanamide.
| Compound Name | (2R)-6-amino-N-[(1R)-2-amino-1-phenylethyl]-2-[(3S)-3-cyclopentyl-3-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-2-oxopropyl]hexanamide |
|---|---|
| PubChem CID | 162174004 |
| Molecular Formula | C38H51N5O4 |
| Molecular Weight | 641.86 g/mol |
| Exact Mass | 641.39 |
| IUPAC Name | (2R)-6-amino-N-[(1R)-2-amino-1-phenylethyl]-2-[(3S)-3-cyclopentyl-3-[[(2S)-3-naphthalen-2-yl-2-(propanoylamino)propanoyl]amino]-2-oxopropyl]hexanamide |
| SMILES | CCC(=O)N[C@@H](Cc1ccc2ccccc2c1)C(=O)N[C@H](C(=O)C[C@@H](CCCCN)C(=O)N[C@@H](CN)c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C38H51N5O4/c1-2-35(45)41-32(23-26-19-20-27-12-6-9-17-30(27)22-26)38(47)43-36(29-15-7-8-16-29)34(44)24-31(18-10-11-21-39)37(46)42-33(25-40)28-13-4-3-5-14-28/h3-6,9,12-14,17,19-20,22,29,31-33,36H,2,7-8,10-11,15-16,18,21,23-25,39-40H2,1H3,(H,41,45)(H,42,46)(H,43,47)/t31-,32+,33+,36+/m1/s1 |
| InChIKey | ZODOJMVNECOCJK-ZAFHBNPNSA-N |
| XLogP | 4.47 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.86 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|