About 4-aminophenol;2-bromoaniline
4-aminophenol;2-bromoaniline (PubChem CID 159371266) has the molecular formula C12H13BrN2O
and a molecular weight of 281.15 g/mol. Its IUPAC name is 4-aminophenol;2-bromoaniline.
Molecular Properties
| Compound Name | 4-aminophenol;2-bromoaniline |
| PubChem CID | 159371266 |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 4-aminophenol;2-bromoaniline |
| SMILES | Nc1ccc(O)cc1.Nc1ccccc1Br |
| InChI | InChI=1S/C6H6BrN.C6H7NO/c7-5-3-1-2-4-6(5)8;7-5-1-3-6(8)4-2-5/h1-4H,8H2;1-4,8H,7H2 |
| InChIKey | LJTUZMYLXBDJRG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;2-bromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;2-bromoaniline?
The IUPAC name of 4-aminophenol;2-bromoaniline (CID 159371266) is 4-aminophenol;2-bromoaniline.
What is the SMILES notation for 4-aminophenol;2-bromoaniline?
The canonical SMILES for 4-aminophenol;2-bromoaniline is Nc1ccc(O)cc1.Nc1ccccc1Br.
What is the InChIKey of 4-aminophenol;2-bromoaniline?
The InChIKey is LJTUZMYLXBDJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.C6H7NO/c7-5-3-1-2-4-6(5)8;7-5-1-3-6(8)4-2-5/h1-4H,8H2;1-4,8H,7H2.
What are the key properties of 4-aminophenol;2-bromoaniline?
4-aminophenol;2-bromoaniline has a molecular weight of 281.15 g/mol, XLogP of 3.01, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;2-bromoaniline is sourced from PubChem (CID 159371266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).