C53H64N2O11 — CID 159372152
benzyl N-[3-[3-[2-(3,4-dihydroxyphenyl)ethylamino]-3-oxopropyl]-5,7-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]carbamate (PubChem CID 159372152) has the molecular formula C53H64N2O11 and a molecular weight of 905.10 g/mol. Its IUPAC name is benzyl N-[3-[3-[2-(3,4-dihydroxyphenyl)ethylamino]-3-oxopropyl]-5,7-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]carbamate.
| Compound Name | benzyl N-[3-[3-[2-(3,4-dihydroxyphenyl)ethylamino]-3-oxopropyl]-5,7-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 159372152 |
| Molecular Formula | C53H64N2O11 |
| Molecular Weight | 905.10 g/mol |
| Exact Mass | 904.45 |
| IUPAC Name | benzyl N-[3-[3-[2-(3,4-dihydroxyphenyl)ethylamino]-3-oxopropyl]-5,7-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]carbamate |
| SMILES | O=C(CCCc1ccc(O)c(O)c1)CCC12CC3(CCC(=O)CCCc4ccc(O)c(O)c4)CC(CCC(=O)NCCc4ccc(O)c(O)c4)(C1)CC(NC(=O)OCc1ccccc1)(C2)C3 |
| InChI | InChI=1S/C53H64N2O11/c56-40(10-4-8-36-12-15-42(58)45(61)26-36)18-22-50-30-51(23-19-41(57)11-5-9-37-13-16-43(59)46(62)27-37)32-52(31-50,24-20-48(64)54-25-21-38-14-17-44(60)47(63)28-38)35-53(33-50,34-51)55-49(65)66-29-39-6-2-1-3-7-39/h1-3,6-7,12-17,26-28,58-63H,4-5,8-11,18-25,29-35H2,(H,54,64)(H,55,65) |
| InChIKey | HUAUQQFRTNEWKR-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 222.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 66 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 905.10 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|