C31H38N2O11 — CID 158835095
6-carbamoyl-11-(3,4-dihydroxyphenyl)-3-[5-[2-(3,4-dihydroxyphenyl)ethylamino]-2,5-dioxopentyl]-4,8-dioxoundecanoic acid (PubChem CID 158835095) has the molecular formula C31H38N2O11 and a molecular weight of 614.65 g/mol. Its IUPAC name is 6-carbamoyl-11-(3,4-dihydroxyphenyl)-3-[5-[2-(3,4-dihydroxyphenyl)ethylamino]-2,5-dioxopentyl]-4,8-dioxoundecanoic acid.
| Compound Name | 6-carbamoyl-11-(3,4-dihydroxyphenyl)-3-[5-[2-(3,4-dihydroxyphenyl)ethylamino]-2,5-dioxopentyl]-4,8-dioxoundecanoic acid |
|---|---|
| PubChem CID | 158835095 |
| Molecular Formula | C31H38N2O11 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 6-carbamoyl-11-(3,4-dihydroxyphenyl)-3-[5-[2-(3,4-dihydroxyphenyl)ethylamino]-2,5-dioxopentyl]-4,8-dioxoundecanoic acid |
| SMILES | NC(=O)C(CC(=O)CCCc1ccc(O)c(O)c1)CC(=O)C(CC(=O)O)CC(=O)CCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C31H38N2O11/c32-31(44)21(15-22(34)3-1-2-18-4-7-24(36)27(39)12-18)16-26(38)20(17-30(42)43)14-23(35)6-9-29(41)33-11-10-19-5-8-25(37)28(40)13-19/h4-5,7-8,12-13,20-21,36-37,39-40H,1-3,6,9-11,14-17H2,(H2,32,44)(H,33,41)(H,42,43) |
| InChIKey | XJOVTWKHBFOBJS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 241.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|