C45H57NO9 — CID 157395341
3-[3,5-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]-N-[2-(3,4-dihydroxyphenyl)ethyl]propanamide (PubChem CID 157395341) has the molecular formula C45H57NO9 and a molecular weight of 755.95 g/mol. Its IUPAC name is 3-[3,5-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]-N-[2-(3,4-dihydroxyphenyl)ethyl]propanamide.
| Compound Name | 3-[3,5-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]-N-[2-(3,4-dihydroxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 157395341 |
| Molecular Formula | C45H57NO9 |
| Molecular Weight | 755.95 g/mol |
| Exact Mass | 755.40 |
| IUPAC Name | 3-[3,5-bis[6-(3,4-dihydroxyphenyl)-3-oxohexyl]-1-adamantyl]-N-[2-(3,4-dihydroxyphenyl)ethyl]propanamide |
| SMILES | O=C(CCCc1ccc(O)c(O)c1)CCC12CC3CC(CCC(=O)CCCc4ccc(O)c(O)c4)(C1)CC(CCC(=O)NCCc1ccc(O)c(O)c1)(C3)C2 |
| InChI | InChI=1S/C45H57NO9/c47-34(5-1-3-30-7-10-36(49)39(52)21-30)13-17-43-24-33-25-44(27-43,18-14-35(48)6-2-4-31-8-11-37(50)40(53)22-31)29-45(26-33,28-43)19-15-42(55)46-20-16-32-9-12-38(51)41(54)23-32/h7-12,21-23,33,49-54H,1-6,13-20,24-29H2,(H,46,55) |
| InChIKey | FSDYEBWTKGQYBV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 184.62 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.95 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|