C25H28ClNO3 — CID 66619659
7-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]tricyclo[3.3.1.11,3]decane-3-carboxamide (PubChem CID 66619659) has the molecular formula C25H28ClNO3 and a molecular weight of 425.96 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]tricyclo[3.3.1.11,3]decane-3-carboxamide.
| Compound Name | 7-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]tricyclo[3.3.1.11,3]decane-3-carboxamide |
|---|---|
| PubChem CID | 66619659 |
| Molecular Formula | C25H28ClNO3 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 7-(4-chlorophenyl)-N-[2-(3,4-dihydroxyphenyl)ethyl]tricyclo[3.3.1.11,3]decane-3-carboxamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)C12CC3CC(c4ccc(Cl)cc4)CC(C3)(C1)C2 |
| InChI | InChI=1S/C25H28ClNO3/c26-20-4-2-18(3-5-20)19-9-17-11-24(13-19)14-25(12-17,15-24)23(30)27-8-7-16-1-6-21(28)22(29)10-16/h1-6,10,17,19,28-29H,7-9,11-15H2,(H,27,30) |
| InChIKey | NOJBSIHHVBQVKL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|