furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid

C9H6F3NO3 — CID 159372864

IUPACfuro[3,2-b]pyridine;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.c1cnc2ccoc2c1
InChIInChI=1S/C7H5NO.C2HF3O2/c1-2-7-6(8-4-1)3-5-9-7;3-2(4,5)1(6)7/h1-5H;(H,6,7)
InChIKeyLJYMSYMFRCRSMD-UHFFFAOYSA-N
MW233.15 g/mol
LogP2.46
Rot. Bonds

About furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid

furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 159372864) has the molecular formula C9H6F3NO3 and a molecular weight of 233.15 g/mol. Its IUPAC name is furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Namefuro[3,2-b]pyridine;2,2,2-trifluoroacetic acid
PubChem CID159372864
Molecular FormulaC9H6F3NO3
Molecular Weight233.15 g/mol
Exact Mass233.03
IUPAC Namefuro[3,2-b]pyridine;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.c1cnc2ccoc2c1
InChIInChI=1S/C7H5NO.C2HF3O2/c1-2-7-6(8-4-1)3-5-9-7;3-2(4,5)1(6)7/h1-5H;(H,6,7)
InChIKeyLJYMSYMFRCRSMD-UHFFFAOYSA-N
XLogP2.46
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.15
LogP ≤ 52.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid?
The IUPAC name of furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid (CID 159372864) is furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid?
The canonical SMILES for furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.c1cnc2ccoc2c1.
What is the InChIKey of furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid?
The InChIKey is LJYMSYMFRCRSMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C2HF3O2/c1-2-7-6(8-4-1)3-5-9-7;3-2(4,5)1(6)7/h1-5H;(H,6,7).
What are the key properties of furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid?
furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid has a molecular weight of 233.15 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 159372864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).