C10H8F2N2S — CID 159377153
N-cyano-2-(4,5-difluoro-2-methylphenyl)ethanethioamide (PubChem CID 159377153) has the molecular formula C10H8F2N2S and a molecular weight of 226.25 g/mol. Its IUPAC name is N-cyano-2-(4,5-difluoro-2-methylphenyl)ethanethioamide.
| Compound Name | N-cyano-2-(4,5-difluoro-2-methylphenyl)ethanethioamide |
|---|---|
| PubChem CID | 159377153 |
| Molecular Formula | C10H8F2N2S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | N-cyano-2-(4,5-difluoro-2-methylphenyl)ethanethioamide |
| SMILES | Cc1cc(F)c(F)cc1CC(=S)NC#N |
| InChI | InChI=1S/C10H8F2N2S/c1-6-2-8(11)9(12)3-7(6)4-10(15)14-5-13/h2-3H,4H2,1H3,(H,14,15) |
| InChIKey | LKLRESSLVPYEBI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|