About 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane
2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane (PubChem CID 159385703) has the molecular formula C38H30N4Si
and a molecular weight of 570.77 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane |
| PubChem CID | 159385703 |
| Molecular Formula | C38H30N4Si |
| Molecular Weight | 570.77 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane |
| SMILES | c1ccc(-c2ccccn2)nc1.c1ccc([Si](c2ccccc2)(c2ccccc2)c2cccnc2-c2ccccn2)cc1 |
| InChI | InChI=1S/C28H22N2Si.C10H8N2/c1-4-13-23(14-5-1)31(24-15-6-2-7-16-24,25-17-8-3-9-18-25)27-20-12-22-30-28(27)26-19-10-11-21-29-26;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-22H;1-8H |
| InChIKey | LLLRQDUCCSSHMC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.77 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane?
The IUPAC name of 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane (CID 159385703) is 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane.
What is the SMILES notation for 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane?
The canonical SMILES for 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane is c1ccc(-c2ccccn2)nc1.c1ccc([Si](c2ccccc2)(c2ccccc2)c2cccnc2-c2ccccn2)cc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane?
The InChIKey is LLLRQDUCCSSHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22N2Si.C10H8N2/c1-4-13-23(14-5-1)31(24-15-6-2-7-16-24,25-17-8-3-9-18-25)27-20-12-22-30-28(27)26-19-10-11-21-29-26;1-3-7-11-9(5-1)10-6-2-4-8-12-10/h1-22H;1-8H.
What are the key properties of 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane?
2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane has a molecular weight of 570.77 g/mol, XLogP of 5.66, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;triphenyl-(2-pyridin-2-yl-3-pyridinyl)silane is sourced from PubChem (CID 159385703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).