C23H22F5NO4S2 — CID 159413503
(1S,2R,7S,10R)-12,15-difluoro-5-methylidene-10-[4-(trifluoromethyl)phenyl]sulfonyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5-oxide (PubChem CID 159413503) has the molecular formula C23H22F5NO4S2 and a molecular weight of 535.56 g/mol. Its IUPAC name is (1S,2R,7S,10R)-12,15-difluoro-5-methylidene-10-[4-(trifluoromethyl)phenyl]sulfonyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5-oxide.
| Compound Name | (1S,2R,7S,10R)-12,15-difluoro-5-methylidene-10-[4-(trifluoromethyl)phenyl]sulfonyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5-oxide |
|---|---|
| PubChem CID | 159413503 |
| Molecular Formula | C23H22F5NO4S2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (1S,2R,7S,10R)-12,15-difluoro-5-methylidene-10-[4-(trifluoromethyl)phenyl]sulfonyl-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5-oxide |
| SMILES | C=S1(=O)CC[C@H]2[C@H](CC[C@]3(S(=O)(=O)c4ccc(C(F)(F)F)cc4)c4c(F)ccc(F)c4OC[C@H]23)N1 |
| InChI | InChI=1S/C23H22F5NO4S2/c1-34(30)11-9-15-16-12-33-21-18(25)7-6-17(24)20(21)22(16,10-8-19(15)29-34)35(31,32)14-4-2-13(3-5-14)23(26,27)28/h2-7,15-16,19H,1,8-12H2,(H,29,30)/t15-,16-,19+,22-,34?/m1/s1 |
| InChIKey | COXBTGGIYZMPEN-ADOXHPENSA-N |
| XLogP | 4.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|