C21H19F5O5S — CID 58950137
(6aR,7R,8R,10aS)-1,4-difluoro-7-(hydroxymethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol (PubChem CID 58950137) has the molecular formula C21H19F5O5S and a molecular weight of 478.44 g/mol. Its IUPAC name is (6aR,7R,8R,10aS)-1,4-difluoro-7-(hydroxymethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol.
| Compound Name | (6aR,7R,8R,10aS)-1,4-difluoro-7-(hydroxymethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
|---|---|
| PubChem CID | 58950137 |
| Molecular Formula | C21H19F5O5S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | (6aR,7R,8R,10aS)-1,4-difluoro-7-(hydroxymethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)[C@@]12CC[C@@H](O)[C@@H](CO)[C@@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C21H19F5O5S/c22-15-5-6-16(23)19-18(15)20(8-7-17(28)13(9-27)14(20)10-31-19)32(29,30)12-3-1-11(2-4-12)21(24,25)26/h1-6,13-14,17,27-28H,7-10H2/t13-,14-,17+,20-/m0/s1 |
| InChIKey | NLOAFNZJTNLBMC-ZEWMMAHBSA-N |
| XLogP | 3.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |