C23H23F5O5S2 — CID 161357769
(6aR,8R,10aS)-1,4-difluoro-8-(2-methylsulfonylethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 161357769) has the molecular formula C23H23F5O5S2 and a molecular weight of 538.56 g/mol. Its IUPAC name is (6aR,8R,10aS)-1,4-difluoro-8-(2-methylsulfonylethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aR,8R,10aS)-1,4-difluoro-8-(2-methylsulfonylethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 161357769 |
| Molecular Formula | C23H23F5O5S2 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | (6aR,8R,10aS)-1,4-difluoro-8-(2-methylsulfonylethyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | CS(=O)(=O)CC[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C23H23F5O5S2/c1-34(29,30)11-9-14-8-10-22(35(31,32)17-4-2-15(3-5-17)23(26,27)28)16(12-14)13-33-21-19(25)7-6-18(24)20(21)22/h2-7,14,16H,8-13H2,1H3/t14-,16+,22-/m0/s1 |
| InChIKey | ZGXHDSFLEOGUAR-PGKMIFDNSA-N |
| XLogP | 4.90 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |