C21H20F4O3S — CID 70314424
(6aR,10aS)-1-fluoro-4-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 70314424) has the molecular formula C21H20F4O3S and a molecular weight of 428.45 g/mol. Its IUPAC name is (6aR,10aS)-1-fluoro-4-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aR,10aS)-1-fluoro-4-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 70314424 |
| Molecular Formula | C21H20F4O3S |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (6aR,10aS)-1-fluoro-4-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | Cc1ccc(F)c2c1OC[C@H]1CCCC[C@@]21S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H20F4O3S/c1-13-5-10-17(22)18-19(13)28-12-15-4-2-3-11-20(15,18)29(26,27)16-8-6-14(7-9-16)21(23,24)25/h5-10,15H,2-4,11-12H2,1H3/t15-,20+/m1/s1 |
| InChIKey | SQXFSLBGADJUCY-QRWLVFNGSA-N |
| XLogP | 5.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |