C21H17F5O4S — CID 58950262
(6aS,7R,10aR)-1,4-difluoro-7-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one (PubChem CID 58950262) has the molecular formula C21H17F5O4S and a molecular weight of 460.42 g/mol. Its IUPAC name is (6aS,7R,10aR)-1,4-difluoro-7-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one.
| Compound Name | (6aS,7R,10aR)-1,4-difluoro-7-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one |
|---|---|
| PubChem CID | 58950262 |
| Molecular Formula | C21H17F5O4S |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (6aS,7R,10aR)-1,4-difluoro-7-methyl-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-one |
| SMILES | C[C@H]1C(=O)CC[C@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@H]12 |
| InChI | InChI=1S/C21H17F5O4S/c1-11-14-10-30-19-16(23)7-6-15(22)18(19)20(14,9-8-17(11)27)31(28,29)13-4-2-12(3-5-13)21(24,25)26/h2-7,11,14H,8-10H2,1H3/t11-,14-,20-/m1/s1 |
| InChIKey | PSOKMPWHYDGDEE-QRVQBPJGSA-N |
| XLogP | 4.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |