C22H19F5O6S2 — CID 118984200
(4S,10bS)-7,10-difluoro-4-[(E)-2-methylsulfonylethenyl]-10b-[4-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene (PubChem CID 118984200) has the molecular formula C22H19F5O6S2 and a molecular weight of 538.51 g/mol. Its IUPAC name is (4S,10bS)-7,10-difluoro-4-[(E)-2-methylsulfonylethenyl]-10b-[4-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene.
| Compound Name | (4S,10bS)-7,10-difluoro-4-[(E)-2-methylsulfonylethenyl]-10b-[4-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
|---|---|
| PubChem CID | 118984200 |
| Molecular Formula | C22H19F5O6S2 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | (4S,10bS)-7,10-difluoro-4-[(E)-2-methylsulfonylethenyl]-10b-[4-(trifluoromethyl)phenyl]sulfonyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
| SMILES | CS(=O)(=O)/C=C/[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OCC12 |
| InChI | InChI=1S/C22H19F5O6S2/c1-34(28,29)11-8-18-15-12-33-20-17(24)7-6-16(23)19(20)21(15,9-10-32-18)35(30,31)14-4-2-13(3-5-14)22(25,26)27/h2-8,11,15,18H,9-10,12H2,1H3/b11-8+/t15?,18-,21-/m0/s1 |
| InChIKey | HJHXIQQMHQIZKJ-VCCFJNQFSA-N |
| XLogP | 4.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |