C19H18ClF2NO4S — CID 58950282
[(4R,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]methanamine (PubChem CID 58950282) has the molecular formula C19H18ClF2NO4S and a molecular weight of 429.87 g/mol. Its IUPAC name is [(4R,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]methanamine.
| Compound Name | [(4R,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]methanamine |
|---|---|
| PubChem CID | 58950282 |
| Molecular Formula | C19H18ClF2NO4S |
| Molecular Weight | 429.87 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | [(4R,4aS,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]methanamine |
| SMILES | NC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12 |
| InChI | InChI=1S/C19H18ClF2NO4S/c20-11-1-3-12(4-2-11)28(24,25)19-7-8-26-16(9-23)13(19)10-27-18-15(22)6-5-14(21)17(18)19/h1-6,13,16H,7-10,23H2/t13-,16-,19-/m0/s1 |
| InChIKey | JACGDQHDTGXWQY-AXHNFQJDSA-N |
| XLogP | 3.04 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |