C22H21ClF2O6S — CID 70315103
2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl acetate (PubChem CID 70315103) has the molecular formula C22H21ClF2O6S and a molecular weight of 486.92 g/mol. Its IUPAC name is 2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl acetate.
| Compound Name | 2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl acetate |
|---|---|
| PubChem CID | 70315103 |
| Molecular Formula | C22H21ClF2O6S |
| Molecular Weight | 486.92 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC12 |
| InChI | InChI=1S/C22H21ClF2O6S/c1-13(26)29-10-8-19-16-12-31-21-18(25)7-6-17(24)20(21)22(16,9-11-30-19)32(27,28)15-4-2-14(23)3-5-15/h2-7,16,19H,8-12H2,1H3/t16?,19-,22-/m0/s1 |
| InChIKey | IKHWELMBUVKYHX-GNAUSZLLSA-N |
| XLogP | 4.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |