C27H25ClF2O7S2 — CID 89436354
2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 89436354) has the molecular formula C27H25ClF2O7S2 and a molecular weight of 599.07 g/mol. Its IUPAC name is 2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89436354 |
| Molecular Formula | C27H25ClF2O7S2 |
| Molecular Weight | 599.07 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-[(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromen-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H]2OCC[C@@]3(S(=O)(=O)c4ccc(Cl)cc4)c4c(F)ccc(F)c4OCC23)cc1 |
| InChI | InChI=1S/C27H25ClF2O7S2/c1-17-2-6-20(7-3-17)39(33,34)37-14-12-24-21-16-36-26-23(30)11-10-22(29)25(26)27(21,13-15-35-24)38(31,32)19-8-4-18(28)5-9-19/h2-11,21,24H,12-16H2,1H3/t21?,24-,27-/m0/s1 |
| InChIKey | QWCVEWGIGKKEFR-DHERDKLVSA-N |
| XLogP | 5.19 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.07 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|