C24H25F5O5S2 — CID 143744200
(6aS,7R,10aR)-1,4-difluoro-7-(3-methylsulfonylpropyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 143744200) has the molecular formula C24H25F5O5S2 and a molecular weight of 552.58 g/mol. Its IUPAC name is (6aS,7R,10aR)-1,4-difluoro-7-(3-methylsulfonylpropyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aS,7R,10aR)-1,4-difluoro-7-(3-methylsulfonylpropyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 143744200 |
| Molecular Formula | C24H25F5O5S2 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | (6aS,7R,10aR)-1,4-difluoro-7-(3-methylsulfonylpropyl)-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | CS(=O)(=O)CCC[C@H]1CCC[C@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@H]12 |
| InChI | InChI=1S/C24H25F5O5S2/c1-35(30,31)13-3-5-15-4-2-12-23(18(15)14-34-22-20(26)11-10-19(25)21(22)23)36(32,33)17-8-6-16(7-9-17)24(27,28)29/h6-11,15,18H,2-5,12-14H2,1H3/t15-,18-,23-/m1/s1 |
| InChIKey | XPEFMAWLRPCFLM-OMXJDXKCSA-N |
| XLogP | 5.29 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |