C22H20ClF5O5S2 — CID 25165412
(6aR,7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-[2-(trifluoromethylsulfonyl)ethyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 25165412) has the molecular formula C22H20ClF5O5S2 and a molecular weight of 558.97 g/mol. Its IUPAC name is (6aR,7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-[2-(trifluoromethylsulfonyl)ethyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aR,7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-[2-(trifluoromethylsulfonyl)ethyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 25165412 |
| Molecular Formula | C22H20ClF5O5S2 |
| Molecular Weight | 558.97 g/mol |
| Exact Mass | 558.04 |
| IUPAC Name | (6aR,7S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-7-[2-(trifluoromethylsulfonyl)ethyl]-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | O=S(=O)(CC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@@H]12)C(F)(F)F |
| InChI | InChI=1S/C22H20ClF5O5S2/c23-14-3-5-15(6-4-14)35(31,32)21-10-1-2-13(9-11-34(29,30)22(26,27)28)16(21)12-33-20-18(25)8-7-17(24)19(20)21/h3-8,13,16H,1-2,9-12H2/t13-,16-,21-/m0/s1 |
| InChIKey | DEYJHEVWVMRRNU-PCMMCCAGSA-N |
| XLogP | 5.42 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.97 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |