C21H22ClF2NO5S2 — CID 58950353
N-[[(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]methanesulfonamide (PubChem CID 58950353) has the molecular formula C21H22ClF2NO5S2 and a molecular weight of 505.99 g/mol. Its IUPAC name is N-[[(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58950353 |
| Molecular Formula | C21H22ClF2NO5S2 |
| Molecular Weight | 505.99 g/mol |
| Exact Mass | 505.06 |
| IUPAC Name | N-[[(7R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC12 |
| InChI | InChI=1S/C21H22ClF2NO5S2/c1-31(26,27)25-11-13-3-2-10-21(32(28,29)15-6-4-14(22)5-7-15)16(13)12-30-20-18(24)9-8-17(23)19(20)21/h4-9,13,16,25H,2-3,10-12H2,1H3/t13-,16?,21-/m0/s1 |
| InChIKey | XOAPSYIOZFDBPZ-ZFANIMLASA-N |
| XLogP | 3.65 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.99 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |