C22H21F5O4S — CID 58950048
2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethanol (PubChem CID 58950048) has the molecular formula C22H21F5O4S and a molecular weight of 476.46 g/mol. Its IUPAC name is 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethanol.
| Compound Name | 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethanol |
|---|---|
| PubChem CID | 58950048 |
| Molecular Formula | C22H21F5O4S |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-[(6aR,8R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]ethanol |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)[C@@]12CC[C@@H](CCO)C[C@@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C22H21F5O4S/c23-17-5-6-18(24)20-19(17)21(9-7-13(8-10-28)11-15(21)12-31-20)32(29,30)16-3-1-14(2-4-16)22(25,26)27/h1-6,13,15,28H,7-12H2/t13-,15+,21-/m0/s1 |
| InChIKey | XFEYIWGMLBBMPC-KUUHDYPXSA-N |
| XLogP | 4.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |