C19H17ClF2O4S — CID 58950328
(6aR,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol (PubChem CID 58950328) has the molecular formula C19H17ClF2O4S and a molecular weight of 414.86 g/mol. Its IUPAC name is (6aR,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol.
| Compound Name | (6aR,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
|---|---|
| PubChem CID | 58950328 |
| Molecular Formula | C19H17ClF2O4S |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | (6aR,8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-ol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@@]12CC[C@H](O)C[C@@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C19H17ClF2O4S/c20-12-1-3-14(4-2-12)27(24,25)19-8-7-13(23)9-11(19)10-26-18-16(22)6-5-15(21)17(18)19/h1-6,11,13,23H,7-10H2/t11-,13+,19+/m1/s1 |
| InChIKey | WTXUIYHQKGABGR-AGMRTUQYSA-N |
| XLogP | 3.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |