C18H17ClF2N2O3S — CID 143513879
(10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-chromeno[3,4-c]pyridin-3-amine (PubChem CID 143513879) has the molecular formula C18H17ClF2N2O3S and a molecular weight of 414.86 g/mol. Its IUPAC name is (10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-chromeno[3,4-c]pyridin-3-amine.
| Compound Name | (10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-chromeno[3,4-c]pyridin-3-amine |
|---|---|
| PubChem CID | 143513879 |
| Molecular Formula | C18H17ClF2N2O3S |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-2,4,4a,5-tetrahydro-1H-chromeno[3,4-c]pyridin-3-amine |
| SMILES | NN1CC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC2C1 |
| InChI | InChI=1S/C18H17ClF2N2O3S/c19-12-1-3-13(4-2-12)27(24,25)18-7-8-23(22)9-11(18)10-26-17-15(21)6-5-14(20)16(17)18/h1-6,11H,7-10,22H2/t11?,18-/m0/s1 |
| InChIKey | ZWERQULBEKVCKH-MCEAHNFKSA-N |
| XLogP | 2.88 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|