C20H16ClF5O4S — CID 143513899
(8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-ol (PubChem CID 143513899) has the molecular formula C20H16ClF5O4S and a molecular weight of 482.85 g/mol. Its IUPAC name is (8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-ol.
| Compound Name | (8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-ol |
|---|---|
| PubChem CID | 143513899 |
| Molecular Formula | C20H16ClF5O4S |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | (8S,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-8-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-benzo[c]chromen-8-ol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@@]12CC[C@@](O)(C(F)(F)F)CC1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C20H16ClF5O4S/c21-12-1-3-13(4-2-12)31(28,29)19-8-7-18(27,20(24,25)26)9-11(19)10-30-17-15(23)6-5-14(22)16(17)19/h1-6,11,27H,7-10H2/t11?,18-,19-/m0/s1 |
| InChIKey | HPXHFGXLYNFLGM-APBAQLNHSA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |