C22H22ClF2NO5S — CID 58950085
N-[(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]-2-methoxyacetamide (PubChem CID 58950085) has the molecular formula C22H22ClF2NO5S and a molecular weight of 485.94 g/mol. Its IUPAC name is N-[(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]-2-methoxyacetamide.
| Compound Name | N-[(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 58950085 |
| Molecular Formula | C22H22ClF2NO5S |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | N-[(6aR,8R,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-8-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H]1CC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OC[C@H]2C1 |
| InChI | InChI=1S/C22H22ClF2NO5S/c1-30-12-19(27)26-15-8-9-22(32(28,29)16-4-2-14(23)3-5-16)13(10-15)11-31-21-18(25)7-6-17(24)20(21)22/h2-7,13,15H,8-12H2,1H3,(H,26,27)/t13-,15-,22+/m1/s1 |
| InChIKey | SFEGRSJWFONHQH-QCPUYCGNSA-N |
| XLogP | 3.61 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |